C22H24N4O2 — CID 109068073
N-(3-phenylpropyl)-3-(pyrrolidine-1-carbonyl)imidazo[1,5-a]pyridine-1-carboxamide (PubChem CID 109068073) has the molecular formula C22H24N4O2 and a molecular weight of 376.46 g/mol. Its IUPAC name is N-(3-phenylpropyl)-3-(pyrrolidine-1-carbonyl)imidazo[1,5-a]pyridine-1-carboxamide.
| Compound Name | N-(3-phenylpropyl)-3-(pyrrolidine-1-carbonyl)imidazo[1,5-a]pyridine-1-carboxamide |
|---|---|
| PubChem CID | 109068073 |
| Molecular Formula | C22H24N4O2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | N-(3-phenylpropyl)-3-(pyrrolidine-1-carbonyl)imidazo[1,5-a]pyridine-1-carboxamide |
| SMILES | O=C(NCCCc1ccccc1)c1nc(C(=O)N2CCCC2)n2ccccc12 |
| InChI | InChI=1S/C22H24N4O2/c27-21(23-13-8-11-17-9-2-1-3-10-17)19-18-12-4-5-16-26(18)20(24-19)22(28)25-14-6-7-15-25/h1-5,9-10,12,16H,6-8,11,13-15H2,(H,23,27) |
| InChIKey | VETDBJODZQXULV-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 66.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|