C30H52O2Si — CID 10906830
1-[(1S,3aS,4aR)-1-[tert-butyl(dimethyl)silyl]oxy-2,2,3a-trimethyl-3,4,5,6,7,8-hexahydro-1H-cyclopenta[a]inden-4a-yl]-3,3,5-trimethylhex-5-en-2-one (PubChem CID 10906830) has the molecular formula C30H52O2Si and a molecular weight of 472.83 g/mol. Its IUPAC name is 1-[(1S,3aS,4aR)-1-[tert-butyl(dimethyl)silyl]oxy-2,2,3a-trimethyl-3,4,5,6,7,8-hexahydro-1H-cyclopenta[a]inden-4a-yl]-3,3,5-trimethylhex-5-en-2-one.
| Compound Name | 1-[(1S,3aS,4aR)-1-[tert-butyl(dimethyl)silyl]oxy-2,2,3a-trimethyl-3,4,5,6,7,8-hexahydro-1H-cyclopenta[a]inden-4a-yl]-3,3,5-trimethylhex-5-en-2-one |
|---|---|
| PubChem CID | 10906830 |
| Molecular Formula | C30H52O2Si |
| Molecular Weight | 472.83 g/mol |
| Exact Mass | 472.37 |
| IUPAC Name | 1-[(1S,3aS,4aR)-1-[tert-butyl(dimethyl)silyl]oxy-2,2,3a-trimethyl-3,4,5,6,7,8-hexahydro-1H-cyclopenta[a]inden-4a-yl]-3,3,5-trimethylhex-5-en-2-one |
| SMILES | C=C(C)CC(C)(C)C(=O)C[C@]12CCCCC1=C1[C@@H](O[Si](C)(C)C(C)(C)C)C(C)(C)C[C@]1(C)C2 |
| InChI | InChI=1S/C30H52O2Si/c1-21(2)17-27(6,7)23(31)18-30-16-14-13-15-22(30)24-25(32-33(11,12)26(3,4)5)28(8,9)19-29(24,10)20-30/h25H,1,13-20H2,2-12H3/t25-,29-,30+/m1/s1 |
| InChIKey | YFSUDEVIYYIEJJ-RKJPZGCHSA-N |
| XLogP | 9.03 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.83 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|