C25H52O4Si2 — CID 10906831
[(1S,3R,4S,5R,6S)-4-methyl-5-tri(propan-2-yl)silyloxy-2,7-dioxabicyclo[4.1.0]heptan-3-yl]methoxy-tri(propan-2-yl)silane (PubChem CID 10906831) has the molecular formula C25H52O4Si2 and a molecular weight of 472.86 g/mol. Its IUPAC name is [(1S,3R,4S,5R,6S)-4-methyl-5-tri(propan-2-yl)silyloxy-2,7-dioxabicyclo[4.1.0]heptan-3-yl]methoxy-tri(propan-2-yl)silane.
| Compound Name | [(1S,3R,4S,5R,6S)-4-methyl-5-tri(propan-2-yl)silyloxy-2,7-dioxabicyclo[4.1.0]heptan-3-yl]methoxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 10906831 |
| Molecular Formula | C25H52O4Si2 |
| Molecular Weight | 472.86 g/mol |
| Exact Mass | 472.34 |
| IUPAC Name | [(1S,3R,4S,5R,6S)-4-methyl-5-tri(propan-2-yl)silyloxy-2,7-dioxabicyclo[4.1.0]heptan-3-yl]methoxy-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](OC[C@@H]1O[C@H]2O[C@H]2[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@H]1C)(C(C)C)C(C)C |
| InChI | InChI=1S/C25H52O4Si2/c1-15(2)30(16(3)4,17(5)6)26-14-22-21(13)23(24-25(27-22)28-24)29-31(18(7)8,19(9)10)20(11)12/h15-25H,14H2,1-13H3/t21-,22-,23+,24-,25-/m0/s1 |
| InChIKey | RXGTVDVVBBFTLM-GIDFYXQGSA-N |
| XLogP | 7.50 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.86 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|