C21H31Cl2NO5Si — CID 10906881
[(3aR,4S,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-(2-amino-4,5-dichlorophenyl)methanone (PubChem CID 10906881) has the molecular formula C21H31Cl2NO5Si and a molecular weight of 476.47 g/mol. Its IUPAC name is [(3aR,4S,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-(2-amino-4,5-dichlorophenyl)methanone.
| Compound Name | [(3aR,4S,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-(2-amino-4,5-dichlorophenyl)methanone |
|---|---|
| PubChem CID | 10906881 |
| Molecular Formula | C21H31Cl2NO5Si |
| Molecular Weight | 476.47 g/mol |
| Exact Mass | 475.13 |
| IUPAC Name | [(3aR,4S,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-(2-amino-4,5-dichlorophenyl)methanone |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@@H]2C(=O)c1cc(Cl)c(Cl)cc1N |
| InChI | InChI=1S/C21H31Cl2NO5Si/c1-20(2,3)30(6,7)26-10-15-17-19(29-21(4,5)28-17)18(27-15)16(25)11-8-12(22)13(23)9-14(11)24/h8-9,15,17-19H,10,24H2,1-7H3/t15-,17-,18-,19-/m1/s1 |
| InChIKey | VQCAKYZDDWHQQT-NXWXRZEISA-N |
| XLogP | 5.07 |
| TPSA | 80.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.47 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|