C20H22N6O — CID 1090691
N-[4-(4-benzylpiperazin-1-yl)phenyl]-1H-1,2,4-triazole-5-carboxamide (PubChem CID 1090691) has the molecular formula C20H22N6O and a molecular weight of 362.44 g/mol. Its IUPAC name is N-[4-(4-benzylpiperazin-1-yl)phenyl]-1H-1,2,4-triazole-5-carboxamide.
| Compound Name | N-[4-(4-benzylpiperazin-1-yl)phenyl]-1H-1,2,4-triazole-5-carboxamide |
|---|---|
| PubChem CID | 1090691 |
| Molecular Formula | C20H22N6O |
| Molecular Weight | 362.44 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | N-[4-(4-benzylpiperazin-1-yl)phenyl]-1H-1,2,4-triazole-5-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCN(Cc3ccccc3)CC2)cc1)c1ncn[nH]1 |
| InChI | InChI=1S/C20H22N6O/c27-20(19-21-15-22-24-19)23-17-6-8-18(9-7-17)26-12-10-25(11-13-26)14-16-4-2-1-3-5-16/h1-9,15H,10-14H2,(H,23,27)(H,21,22,24) |
| InChIKey | OPZDJNRYFSUWNO-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.44 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|