C20H28N4O2 — CID 109071055
1-N-tert-butyl-3-N-cycloheptylimidazo[1,5-a]pyridine-1,3-dicarboxamide (PubChem CID 109071055) has the molecular formula C20H28N4O2 and a molecular weight of 356.47 g/mol. Its IUPAC name is 1-N-tert-butyl-3-N-cycloheptylimidazo[1,5-a]pyridine-1,3-dicarboxamide.
| Compound Name | 1-N-tert-butyl-3-N-cycloheptylimidazo[1,5-a]pyridine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 109071055 |
| Molecular Formula | C20H28N4O2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | 1-N-tert-butyl-3-N-cycloheptylimidazo[1,5-a]pyridine-1,3-dicarboxamide |
| SMILES | CC(C)(C)NC(=O)c1nc(C(=O)NC2CCCCCC2)n2ccccc12 |
| InChI | InChI=1S/C20H28N4O2/c1-20(2,3)23-18(25)16-15-12-8-9-13-24(15)17(22-16)19(26)21-14-10-6-4-5-7-11-14/h8-9,12-14H,4-7,10-11H2,1-3H3,(H,21,26)(H,23,25) |
| InChIKey | UOELFWXKSKGHDX-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 75.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |