C23H31NO6Se — CID 10907174
(4R,5R)-4-methoxy-3-[(1S,2R,4R)-2-(2-methoxyethoxy)-7,7-dimethylbicyclo[2.2.1]heptane-1-carbonyl]-5-phenylselanyl-1,3-oxazolidin-2-one (PubChem CID 10907174) has the molecular formula C23H31NO6Se and a molecular weight of 496.46 g/mol. Its IUPAC name is (4R,5R)-4-methoxy-3-[(1S,2R,4R)-2-(2-methoxyethoxy)-7,7-dimethylbicyclo[2.2.1]heptane-1-carbonyl]-5-phenylselanyl-1,3-oxazolidin-2-one.
| Compound Name | (4R,5R)-4-methoxy-3-[(1S,2R,4R)-2-(2-methoxyethoxy)-7,7-dimethylbicyclo[2.2.1]heptane-1-carbonyl]-5-phenylselanyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 10907174 |
| Molecular Formula | C23H31NO6Se |
| Molecular Weight | 496.46 g/mol |
| Exact Mass | 497.13 |
| IUPAC Name | (4R,5R)-4-methoxy-3-[(1S,2R,4R)-2-(2-methoxyethoxy)-7,7-dimethylbicyclo[2.2.1]heptane-1-carbonyl]-5-phenylselanyl-1,3-oxazolidin-2-one |
| SMILES | COCCO[C@@H]1C[C@H]2CC[C@]1(C(=O)N1C(=O)O[C@H]([Se]c3ccccc3)[C@H]1OC)C2(C)C |
| InChI | InChI=1S/C23H31NO6Se/c1-22(2)15-10-11-23(22,17(14-15)29-13-12-27-3)20(25)24-18(28-4)19(30-21(24)26)31-16-8-6-5-7-9-16/h5-9,15,17-19H,10-14H2,1-4H3/t15-,17-,18-,19-,23+/m1/s1 |
| InChIKey | TYMIWKHGAVREQG-UFVRFAJXSA-N |
| XLogP | 2.15 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.46 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|