C20H34S2Se2 — CID 10907179
(1E)-1-butylsulfanyl-1-[[(1E)-1-butylsulfanyl-3-methylpenta-1,4-dienyl]diselanyl]-3-methylpenta-1,4-diene (PubChem CID 10907179) has the molecular formula C20H34S2Se2 and a molecular weight of 496.55 g/mol. Its IUPAC name is (1E)-1-butylsulfanyl-1-[[(1E)-1-butylsulfanyl-3-methylpenta-1,4-dienyl]diselanyl]-3-methylpenta-1,4-diene.
| Compound Name | (1E)-1-butylsulfanyl-1-[[(1E)-1-butylsulfanyl-3-methylpenta-1,4-dienyl]diselanyl]-3-methylpenta-1,4-diene |
|---|---|
| PubChem CID | 10907179 |
| Molecular Formula | C20H34S2Se2 |
| Molecular Weight | 496.55 g/mol |
| Exact Mass | 498.04 |
| IUPAC Name | (1E)-1-butylsulfanyl-1-[[(1E)-1-butylsulfanyl-3-methylpenta-1,4-dienyl]diselanyl]-3-methylpenta-1,4-diene |
| SMILES | C=CC(C)/C=C(\SCCCC)[Se][Se]/C(=C/C(C)C=C)SCCCC |
| InChI | InChI=1S/C20H34S2Se2/c1-7-11-13-21-19(15-17(5)9-3)23-24-20(16-18(6)10-4)22-14-12-8-2/h9-10,15-18H,3-4,7-8,11-14H2,1-2,5-6H3/b19-15+,20-16+ |
| InChIKey | ALBOLQYFGYKCPS-MXWIWYRXSA-N |
| XLogP | 6.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.55 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|