C18H19F3N4O2 — CID 109072711
3-N-propan-2-yl-1-N-(2,3,4-trifluorophenyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide (PubChem CID 109072711) has the molecular formula C18H19F3N4O2 and a molecular weight of 380.37 g/mol. Its IUPAC name is 3-N-propan-2-yl-1-N-(2,3,4-trifluorophenyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide.
| Compound Name | 3-N-propan-2-yl-1-N-(2,3,4-trifluorophenyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 109072711 |
| Molecular Formula | C18H19F3N4O2 |
| Molecular Weight | 380.37 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 3-N-propan-2-yl-1-N-(2,3,4-trifluorophenyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide |
| SMILES | CC(C)NC(=O)c1nc(C(=O)Nc2ccc(F)c(F)c2F)c2n1CCCC2 |
| InChI | InChI=1S/C18H19F3N4O2/c1-9(2)22-18(27)16-24-15(12-5-3-4-8-25(12)16)17(26)23-11-7-6-10(19)13(20)14(11)21/h6-7,9H,3-5,8H2,1-2H3,(H,22,27)(H,23,26) |
| InChIKey | QGKWDSPUONNHQE-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.37 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|