C25H28FNO9 — CID 10907287
[(2R,3R,4S,5R,6S)-4-acetyloxy-6-ethoxy-2-[(4-fluorophenyl)carbamoyloxymethyl]-5-methoxyoxan-3-yl] benzoate (PubChem CID 10907287) has the molecular formula C25H28FNO9 and a molecular weight of 505.50 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-4-acetyloxy-6-ethoxy-2-[(4-fluorophenyl)carbamoyloxymethyl]-5-methoxyoxan-3-yl] benzoate.
| Compound Name | [(2R,3R,4S,5R,6S)-4-acetyloxy-6-ethoxy-2-[(4-fluorophenyl)carbamoyloxymethyl]-5-methoxyoxan-3-yl] benzoate |
|---|---|
| PubChem CID | 10907287 |
| Molecular Formula | C25H28FNO9 |
| Molecular Weight | 505.50 g/mol |
| Exact Mass | 505.17 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-4-acetyloxy-6-ethoxy-2-[(4-fluorophenyl)carbamoyloxymethyl]-5-methoxyoxan-3-yl] benzoate |
| SMILES | CCO[C@H]1O[C@H](COC(=O)Nc2ccc(F)cc2)[C@@H](OC(=O)c2ccccc2)[C@H](OC(C)=O)[C@H]1OC |
| InChI | InChI=1S/C25H28FNO9/c1-4-32-24-22(31-3)21(34-15(2)28)20(36-23(29)16-8-6-5-7-9-16)19(35-24)14-33-25(30)27-18-12-10-17(26)11-13-18/h5-13,19-22,24H,4,14H2,1-3H3,(H,27,30)/t19-,20-,21+,22-,24+/m1/s1 |
| InChIKey | CIKLWWPSYJAERD-AREVGRJGSA-N |
| XLogP | 3.31 |
| TPSA | 118.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.50 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|