C20H24N4O2 — CID 109072956
3-N-cyclopropyl-1-N-(2-ethylphenyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide (PubChem CID 109072956) has the molecular formula C20H24N4O2 and a molecular weight of 352.44 g/mol. Its IUPAC name is 3-N-cyclopropyl-1-N-(2-ethylphenyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide.
| Compound Name | 3-N-cyclopropyl-1-N-(2-ethylphenyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 109072956 |
| Molecular Formula | C20H24N4O2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | 3-N-cyclopropyl-1-N-(2-ethylphenyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide |
| SMILES | CCc1ccccc1NC(=O)c1nc(C(=O)NC2CC2)n2c1CCCC2 |
| InChI | InChI=1S/C20H24N4O2/c1-2-13-7-3-4-8-15(13)22-19(25)17-16-9-5-6-12-24(16)18(23-17)20(26)21-14-10-11-14/h3-4,7-8,14H,2,5-6,9-12H2,1H3,(H,21,26)(H,22,25) |
| InChIKey | LIOUESYQPAPBCG-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |