C22H27N5O2 — CID 109073075
3-(4-phenylpiperazine-1-carbonyl)-N-prop-2-enyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1-carboxamide (PubChem CID 109073075) has the molecular formula C22H27N5O2 and a molecular weight of 393.49 g/mol. Its IUPAC name is 3-(4-phenylpiperazine-1-carbonyl)-N-prop-2-enyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1-carboxamide.
| Compound Name | 3-(4-phenylpiperazine-1-carbonyl)-N-prop-2-enyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1-carboxamide |
|---|---|
| PubChem CID | 109073075 |
| Molecular Formula | C22H27N5O2 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | 3-(4-phenylpiperazine-1-carbonyl)-N-prop-2-enyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1-carboxamide |
| SMILES | C=CCNC(=O)c1nc(C(=O)N2CCN(c3ccccc3)CC2)n2c1CCCC2 |
| InChI | InChI=1S/C22H27N5O2/c1-2-11-23-21(28)19-18-10-6-7-12-27(18)20(24-19)22(29)26-15-13-25(14-16-26)17-8-4-3-5-9-17/h2-5,8-9H,1,6-7,10-16H2,(H,23,28) |
| InChIKey | ZAOOMJGNJHMBEV-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|