C26H22ClN3O4S — CID 10907320
(1R,2S,5R)-2-[4-(4-chlorophenyl)phenyl]sulfanyl-5-[(2,4-dioxopyrido[1,2-a][1,3,5]triazin-3-yl)methyl]cyclopentane-1-carboxylic acid (PubChem CID 10907320) has the molecular formula C26H22ClN3O4S and a molecular weight of 508.00 g/mol. Its IUPAC name is (1R,2S,5R)-2-[4-(4-chlorophenyl)phenyl]sulfanyl-5-[(2,4-dioxopyrido[1,2-a][1,3,5]triazin-3-yl)methyl]cyclopentane-1-carboxylic acid.
| Compound Name | (1R,2S,5R)-2-[4-(4-chlorophenyl)phenyl]sulfanyl-5-[(2,4-dioxopyrido[1,2-a][1,3,5]triazin-3-yl)methyl]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 10907320 |
| Molecular Formula | C26H22ClN3O4S |
| Molecular Weight | 508.00 g/mol |
| Exact Mass | 507.10 |
| IUPAC Name | (1R,2S,5R)-2-[4-(4-chlorophenyl)phenyl]sulfanyl-5-[(2,4-dioxopyrido[1,2-a][1,3,5]triazin-3-yl)methyl]cyclopentane-1-carboxylic acid |
| SMILES | O=C(O)[C@H]1[C@H](Cn2c(=O)nc3ccccn3c2=O)CC[C@@H]1Sc1ccc(-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C26H22ClN3O4S/c27-19-9-4-16(5-10-19)17-6-11-20(12-7-17)35-21-13-8-18(23(21)24(31)32)15-30-25(33)28-22-3-1-2-14-29(22)26(30)34/h1-7,9-12,14,18,21,23H,8,13,15H2,(H,31,32)/t18-,21-,23-/m0/s1 |
| InChIKey | QOOGIVWLICWQOB-HARLFGEKSA-N |
| XLogP | 4.45 |
| TPSA | 93.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.00 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |