C18H28N4O2 — CID 109073463
3-N-butyl-1-N-cyclopentyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide (PubChem CID 109073463) has the molecular formula C18H28N4O2 and a molecular weight of 332.45 g/mol. Its IUPAC name is 3-N-butyl-1-N-cyclopentyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide.
| Compound Name | 3-N-butyl-1-N-cyclopentyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 109073463 |
| Molecular Formula | C18H28N4O2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | 3-N-butyl-1-N-cyclopentyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide |
| SMILES | CCCCNC(=O)c1nc(C(=O)NC2CCCC2)c2n1CCCC2 |
| InChI | InChI=1S/C18H28N4O2/c1-2-3-11-19-18(24)16-21-15(14-10-6-7-12-22(14)16)17(23)20-13-8-4-5-9-13/h13H,2-12H2,1H3,(H,19,24)(H,20,23) |
| InChIKey | WUHFVFQGRRIHBR-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|