C21H27N5O2 — CID 109074774
3-N-cyclohexyl-1-N-(pyridin-3-ylmethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide (PubChem CID 109074774) has the molecular formula C21H27N5O2 and a molecular weight of 381.48 g/mol. Its IUPAC name is 3-N-cyclohexyl-1-N-(pyridin-3-ylmethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide.
| Compound Name | 3-N-cyclohexyl-1-N-(pyridin-3-ylmethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 109074774 |
| Molecular Formula | C21H27N5O2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | 3-N-cyclohexyl-1-N-(pyridin-3-ylmethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide |
| SMILES | O=C(NCc1cccnc1)c1nc(C(=O)NC2CCCCC2)n2c1CCCC2 |
| InChI | InChI=1S/C21H27N5O2/c27-20(23-14-15-7-6-11-22-13-15)18-17-10-4-5-12-26(17)19(25-18)21(28)24-16-8-2-1-3-9-16/h6-7,11,13,16H,1-5,8-10,12,14H2,(H,23,27)(H,24,28) |
| InChIKey | ZOAKUNUIQFBBMK-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |