C35H60OSi — CID 10907493
tert-butyl-dimethyl-[[(3S,5R,10S,13R,17R)-4,4,10,13-tetramethyl-17-[(2R)-6-methylhept-5-en-2-yl]-1,2,3,5,6,7,11,12,16,17-decahydrocyclopenta[a]phenanthren-3-yl]oxy]silane (PubChem CID 10907493) has the molecular formula C35H60OSi and a molecular weight of 524.95 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(3S,5R,10S,13R,17R)-4,4,10,13-tetramethyl-17-[(2R)-6-methylhept-5-en-2-yl]-1,2,3,5,6,7,11,12,16,17-decahydrocyclopenta[a]phenanthren-3-yl]oxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(3S,5R,10S,13R,17R)-4,4,10,13-tetramethyl-17-[(2R)-6-methylhept-5-en-2-yl]-1,2,3,5,6,7,11,12,16,17-decahydrocyclopenta[a]phenanthren-3-yl]oxy]silane |
|---|---|
| PubChem CID | 10907493 |
| Molecular Formula | C35H60OSi |
| Molecular Weight | 524.95 g/mol |
| Exact Mass | 524.44 |
| IUPAC Name | tert-butyl-dimethyl-[[(3S,5R,10S,13R,17R)-4,4,10,13-tetramethyl-17-[(2R)-6-methylhept-5-en-2-yl]-1,2,3,5,6,7,11,12,16,17-decahydrocyclopenta[a]phenanthren-3-yl]oxy]silane |
| SMILES | CC(C)=CCC[C@@H](C)[C@H]1CC=C2C3=C(CC[C@@]21C)[C@@]1(C)CC[C@H](O[Si](C)(C)C(C)(C)C)C(C)(C)[C@@H]1CC3 |
| InChI | InChI=1S/C35H60OSi/c1-24(2)14-13-15-25(3)27-17-18-28-26-16-19-30-33(7,8)31(36-37(11,12)32(4,5)6)21-23-35(30,10)29(26)20-22-34(27,28)9/h14,18,25,27,30-31H,13,15-17,19-23H2,1-12H3/t25-,27-,30+,31+,34-,35-/m1/s1 |
| InChIKey | LMOCYMUAEXSGEV-FUFWMRPGSA-N |
| XLogP | 11.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.95 |
| LogP ≤ 5 | 11.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|