C19H30N6O3 — CID 109075775
N-[3-(dimethylamino)propyl]-3-(4-formylpiperazine-1-carbonyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1-carboxamide (PubChem CID 109075775) has the molecular formula C19H30N6O3 and a molecular weight of 390.49 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-3-(4-formylpiperazine-1-carbonyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1-carboxamide.
| Compound Name | N-[3-(dimethylamino)propyl]-3-(4-formylpiperazine-1-carbonyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1-carboxamide |
|---|---|
| PubChem CID | 109075775 |
| Molecular Formula | C19H30N6O3 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-3-(4-formylpiperazine-1-carbonyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1-carboxamide |
| SMILES | CN(C)CCCNC(=O)c1nc(C(=O)N2CCN(C=O)CC2)n2c1CCCC2 |
| InChI | InChI=1S/C19H30N6O3/c1-22(2)8-5-7-20-18(27)16-15-6-3-4-9-25(15)17(21-16)19(28)24-12-10-23(14-26)11-13-24/h14H,3-13H2,1-2H3,(H,20,27) |
| InChIKey | PZKGOPLJTYKQAE-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 90.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|