C29H48O7Si — CID 10907610
(1S,5S,6R,7S,8S,12S,15S)-7,10,10,14,17,17-hexamethyl-3-oxo-15-tri(propan-2-yl)silyloxy-2,4,9,11-tetraoxatetracyclo[11.3.1.01,5.08,12]heptadec-13-ene-6-carbaldehyde (PubChem CID 10907610) has the molecular formula C29H48O7Si and a molecular weight of 536.78 g/mol. Its IUPAC name is (1S,5S,6R,7S,8S,12S,15S)-7,10,10,14,17,17-hexamethyl-3-oxo-15-tri(propan-2-yl)silyloxy-2,4,9,11-tetraoxatetracyclo[11.3.1.01,5.08,12]heptadec-13-ene-6-carbaldehyde.
| Compound Name | (1S,5S,6R,7S,8S,12S,15S)-7,10,10,14,17,17-hexamethyl-3-oxo-15-tri(propan-2-yl)silyloxy-2,4,9,11-tetraoxatetracyclo[11.3.1.01,5.08,12]heptadec-13-ene-6-carbaldehyde |
|---|---|
| PubChem CID | 10907610 |
| Molecular Formula | C29H48O7Si |
| Molecular Weight | 536.78 g/mol |
| Exact Mass | 536.32 |
| IUPAC Name | (1S,5S,6R,7S,8S,12S,15S)-7,10,10,14,17,17-hexamethyl-3-oxo-15-tri(propan-2-yl)silyloxy-2,4,9,11-tetraoxatetracyclo[11.3.1.01,5.08,12]heptadec-13-ene-6-carbaldehyde |
| SMILES | CC1=C2[C@@H]3OC(C)(C)O[C@H]3[C@@H](C)[C@@H](C=O)[C@@H]3OC(=O)O[C@@]3(C[C@@H]1O[Si](C(C)C)(C(C)C)C(C)C)C2(C)C |
| InChI | InChI=1S/C29H48O7Si/c1-15(2)37(16(3)4,17(5)6)36-21-13-29-25(32-26(31)35-29)20(14-30)18(7)23-24(34-28(11,12)33-23)22(19(21)8)27(29,9)10/h14-18,20-21,23-25H,13H2,1-12H3/t18-,20+,21-,23-,24-,25-,29+/m0/s1 |
| InChIKey | HUGOPWAJTYTTHE-NJYLAOCNSA-N |
| XLogP | 6.55 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.78 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|