C21H22N4O4 — CID 109076117
1-N-(furan-2-ylmethyl)-3-N-(2-methoxyphenyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide (PubChem CID 109076117) has the molecular formula C21H22N4O4 and a molecular weight of 394.43 g/mol. Its IUPAC name is 1-N-(furan-2-ylmethyl)-3-N-(2-methoxyphenyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide.
| Compound Name | 1-N-(furan-2-ylmethyl)-3-N-(2-methoxyphenyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 109076117 |
| Molecular Formula | C21H22N4O4 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | 1-N-(furan-2-ylmethyl)-3-N-(2-methoxyphenyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide |
| SMILES | COc1ccccc1NC(=O)c1nc(C(=O)NCc2ccco2)c2n1CCCC2 |
| InChI | InChI=1S/C21H22N4O4/c1-28-17-10-3-2-8-15(17)23-21(27)19-24-18(16-9-4-5-11-25(16)19)20(26)22-13-14-7-6-12-29-14/h2-3,6-8,10,12H,4-5,9,11,13H2,1H3,(H,22,26)(H,23,27) |
| InChIKey | PSHNYHGFBLPJGH-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 98.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |