C27H37N2+ — CID 10907628
[(2E,4Z)-5-(diethylamino)-1,5-bis(4-methylphenyl)penta-2,4-dienylidene]-diethylazanium (PubChem CID 10907628) has the molecular formula C27H37N2+ and a molecular weight of 389.61 g/mol. Its IUPAC name is [(2E,4Z)-5-(diethylamino)-1,5-bis(4-methylphenyl)penta-2,4-dienylidene]-diethylazanium.
| Compound Name | [(2E,4Z)-5-(diethylamino)-1,5-bis(4-methylphenyl)penta-2,4-dienylidene]-diethylazanium |
|---|---|
| PubChem CID | 10907628 |
| Molecular Formula | C27H37N2+ |
| Molecular Weight | 389.61 g/mol |
| Exact Mass | 389.30 |
| IUPAC Name | [(2E,4Z)-5-(diethylamino)-1,5-bis(4-methylphenyl)penta-2,4-dienylidene]-diethylazanium |
| SMILES | CCN(CC)/C(=C\C=C\C(c1ccc(C)cc1)=[N+](CC)CC)c1ccc(C)cc1 |
| InChI | InChI=1S/C27H37N2/c1-7-28(8-2)26(24-18-14-22(5)15-19-24)12-11-13-27(29(9-3)10-4)25-20-16-23(6)17-21-25/h11-21H,7-10H2,1-6H3/q+1 |
| InChIKey | VKKCYSNOLMZXKE-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.61 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|