C21H20FN5O2 — CID 109076424
3-N-(3-fluorophenyl)-1-N-(pyridin-2-ylmethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide (PubChem CID 109076424) has the molecular formula C21H20FN5O2 and a molecular weight of 393.42 g/mol. Its IUPAC name is 3-N-(3-fluorophenyl)-1-N-(pyridin-2-ylmethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide.
| Compound Name | 3-N-(3-fluorophenyl)-1-N-(pyridin-2-ylmethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 109076424 |
| Molecular Formula | C21H20FN5O2 |
| Molecular Weight | 393.42 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | 3-N-(3-fluorophenyl)-1-N-(pyridin-2-ylmethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide |
| SMILES | O=C(NCc1ccccn1)c1nc(C(=O)Nc2cccc(F)c2)n2c1CCCC2 |
| InChI | InChI=1S/C21H20FN5O2/c22-14-6-5-8-15(12-14)25-21(29)19-26-18(17-9-2-4-11-27(17)19)20(28)24-13-16-7-1-3-10-23-16/h1,3,5-8,10,12H,2,4,9,11,13H2,(H,24,28)(H,25,29) |
| InChIKey | OUYUZJFANINNOZ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.42 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |