About CID 10907680
CID 10907680 (PubChem CID 10907680) has the molecular formula C33H29FeNOS+2
and a molecular weight of 543.51 g/mol.
Molecular Properties
| Compound Name | CID 10907680 |
| PubChem CID | 10907680 |
| Molecular Formula | C33H29FeNOS+2 |
| Molecular Weight | 543.51 g/mol |
| Exact Mass | 543.13 |
| IUPAC Name | — |
| SMILES | [CH]1[CH][CH][CH][CH]1.[CH]1[CH][C](Sc2ccccc2)[C](C2=NC(Cc3ccccc3)(Cc3ccccc3)CO2)[CH]1.[Fe+2] |
| InChI | InChI=1S/C28H24NOS.C5H5.Fe/c1-4-11-22(12-5-1)19-28(20-23-13-6-2-7-14-23)21-30-27(29-28)25-17-10-18-26(25)31-24-15-8-3-9-16-24;1-2-4-5-3-1;/h1-18H,19-21H2;1-5H;/q;;+2 |
| InChIKey | ZALHIYZIZJJWPV-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 543.51 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 10907680 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 10907680?
The IUPAC name of CID 10907680 (CID 10907680) is not available.
What is the SMILES notation for CID 10907680?
The canonical SMILES for CID 10907680 is [CH]1[CH][CH][CH][CH]1.[CH]1[CH][C](Sc2ccccc2)[C](C2=NC(Cc3ccccc3)(Cc3ccccc3)CO2)[CH]1.[Fe+2].
What is the InChIKey of CID 10907680?
The InChIKey is ZALHIYZIZJJWPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H24NOS.C5H5.Fe/c1-4-11-22(12-5-1)19-28(20-23-13-6-2-7-14-23)21-30-27(29-28)25-17-10-18-26(25)31-24-15-8-3-9-16-24;1-2-4-5-3-1;/h1-18H,19-21H2;1-5H;/q;;+2.
What are the key properties of CID 10907680?
CID 10907680 has a molecular weight of 543.51 g/mol, XLogP of 7.18, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 10907680 is sourced from PubChem (CID 10907680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).