About CID 10907681
CID 10907681 (PubChem CID 10907681) has the molecular formula C28H24NOS
and a molecular weight of 422.57 g/mol.
Molecular Properties
| Compound Name | CID 10907681 |
| PubChem CID | 10907681 |
| Molecular Formula | C28H24NOS |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | — |
| SMILES | [CH]1[CH][C](Sc2ccccc2)[C](C2=NC(Cc3ccccc3)(Cc3ccccc3)CO2)[CH]1 |
| InChI | InChI=1S/C28H24NOS/c1-4-11-22(12-5-1)19-28(20-23-13-6-2-7-14-23)21-30-27(29-28)25-17-10-18-26(25)31-24-15-8-3-9-16-24/h1-18H,19-21H2 |
| InChIKey | YMIBTRPWBZTMGU-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 10907681 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 10907681?
The IUPAC name of CID 10907681 (CID 10907681) is not available.
What is the SMILES notation for CID 10907681?
The canonical SMILES for CID 10907681 is [CH]1[CH][C](Sc2ccccc2)[C](C2=NC(Cc3ccccc3)(Cc3ccccc3)CO2)[CH]1.
What is the InChIKey of CID 10907681?
The InChIKey is YMIBTRPWBZTMGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H24NOS/c1-4-11-22(12-5-1)19-28(20-23-13-6-2-7-14-23)21-30-27(29-28)25-17-10-18-26(25)31-24-15-8-3-9-16-24/h1-18H,19-21H2.
What are the key properties of CID 10907681?
CID 10907681 has a molecular weight of 422.57 g/mol, XLogP of 6.16, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 10907681 is sourced from PubChem (CID 10907681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).