C20H24F2N4O2 — CID 109076990
3-N-(2,6-difluorophenyl)-1-N-(3-methylbutyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide (PubChem CID 109076990) has the molecular formula C20H24F2N4O2 and a molecular weight of 390.43 g/mol. Its IUPAC name is 3-N-(2,6-difluorophenyl)-1-N-(3-methylbutyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide.
| Compound Name | 3-N-(2,6-difluorophenyl)-1-N-(3-methylbutyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 109076990 |
| Molecular Formula | C20H24F2N4O2 |
| Molecular Weight | 390.43 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 3-N-(2,6-difluorophenyl)-1-N-(3-methylbutyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide |
| SMILES | CC(C)CCNC(=O)c1nc(C(=O)Nc2c(F)cccc2F)n2c1CCCC2 |
| InChI | InChI=1S/C20H24F2N4O2/c1-12(2)9-10-23-19(27)17-15-8-3-4-11-26(15)18(24-17)20(28)25-16-13(21)6-5-7-14(16)22/h5-7,12H,3-4,8-11H2,1-2H3,(H,23,27)(H,25,28) |
| InChIKey | BKQJZCKOKWTCLZ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.43 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |