C26H50O8Si2 — CID 10907720
dimethyl (1S,2R,3S,4S,5S,6S)-6-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-1-[tri(propan-2-yl)silyloxymethyl]-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate (PubChem CID 10907720) has the molecular formula C26H50O8Si2 and a molecular weight of 546.85 g/mol. Its IUPAC name is dimethyl (1S,2R,3S,4S,5S,6S)-6-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-1-[tri(propan-2-yl)silyloxymethyl]-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate.
| Compound Name | dimethyl (1S,2R,3S,4S,5S,6S)-6-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-1-[tri(propan-2-yl)silyloxymethyl]-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate |
|---|---|
| PubChem CID | 10907720 |
| Molecular Formula | C26H50O8Si2 |
| Molecular Weight | 546.85 g/mol |
| Exact Mass | 546.30 |
| IUPAC Name | dimethyl (1S,2R,3S,4S,5S,6S)-6-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-1-[tri(propan-2-yl)silyloxymethyl]-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H]2O[C@](CO[Si](C(C)C)(C(C)C)C(C)C)([C@@H]1C(=O)OC)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O |
| InChI | InChI=1S/C26H50O8Si2/c1-15(2)36(16(3)4,17(5)6)32-14-26-19(24(29)31-11)18(23(28)30-10)21(33-26)20(27)22(26)34-35(12,13)25(7,8)9/h15-22,27H,14H2,1-13H3/t18-,19-,20-,21-,22-,26+/m0/s1 |
| InChIKey | IRVOLKVPJBCZFU-JOJUEZHYSA-N |
| XLogP | 4.66 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.85 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|