C30H30O10 — CID 10907755
(3S,3aR,9aR)-8,9a-dihydroxy-6-methoxy-3a-(4-methoxyphenyl)-3-[(E)-2-(2,4,5-trimethoxyphenyl)ethenyl]-2,3-dihydrofuro[3,2-b]chromen-9-one (PubChem CID 10907755) has the molecular formula C30H30O10 and a molecular weight of 550.56 g/mol. Its IUPAC name is (3S,3aR,9aR)-8,9a-dihydroxy-6-methoxy-3a-(4-methoxyphenyl)-3-[(E)-2-(2,4,5-trimethoxyphenyl)ethenyl]-2,3-dihydrofuro[3,2-b]chromen-9-one.
| Compound Name | (3S,3aR,9aR)-8,9a-dihydroxy-6-methoxy-3a-(4-methoxyphenyl)-3-[(E)-2-(2,4,5-trimethoxyphenyl)ethenyl]-2,3-dihydrofuro[3,2-b]chromen-9-one |
|---|---|
| PubChem CID | 10907755 |
| Molecular Formula | C30H30O10 |
| Molecular Weight | 550.56 g/mol |
| Exact Mass | 550.18 |
| IUPAC Name | (3S,3aR,9aR)-8,9a-dihydroxy-6-methoxy-3a-(4-methoxyphenyl)-3-[(E)-2-(2,4,5-trimethoxyphenyl)ethenyl]-2,3-dihydrofuro[3,2-b]chromen-9-one |
| SMILES | COc1ccc([C@@]23Oc4cc(OC)cc(O)c4C(=O)[C@]2(O)OC[C@@H]3/C=C/c2cc(OC)c(OC)cc2OC)cc1 |
| InChI | InChI=1S/C30H30O10/c1-34-20-10-8-18(9-11-20)29-19(7-6-17-12-24(37-4)25(38-5)15-23(17)36-3)16-39-30(29,33)28(32)27-22(31)13-21(35-2)14-26(27)40-29/h6-15,19,31,33H,16H2,1-5H3/b7-6+/t19-,29-,30-/m0/s1 |
| InChIKey | XGWDQUCPQMERCP-WEKIXTCTSA-N |
| XLogP | 3.95 |
| TPSA | 122.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.56 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |