C30H50O7Si — CID 10907758
(1S,5S,6R,7R,11R,12R,16R,19S)-7-hydroxy-7,11,14,14,18,21,21-heptamethyl-19-triethylsilyloxy-2,4,13,15-tetraoxapentacyclo[15.3.1.01,5.06,11.012,16]henicos-17-en-3-one (PubChem CID 10907758) has the molecular formula C30H50O7Si and a molecular weight of 550.81 g/mol. Its IUPAC name is (1S,5S,6R,7R,11R,12R,16R,19S)-7-hydroxy-7,11,14,14,18,21,21-heptamethyl-19-triethylsilyloxy-2,4,13,15-tetraoxapentacyclo[15.3.1.01,5.06,11.012,16]henicos-17-en-3-one.
| Compound Name | (1S,5S,6R,7R,11R,12R,16R,19S)-7-hydroxy-7,11,14,14,18,21,21-heptamethyl-19-triethylsilyloxy-2,4,13,15-tetraoxapentacyclo[15.3.1.01,5.06,11.012,16]henicos-17-en-3-one |
|---|---|
| PubChem CID | 10907758 |
| Molecular Formula | C30H50O7Si |
| Molecular Weight | 550.81 g/mol |
| Exact Mass | 550.33 |
| IUPAC Name | (1S,5S,6R,7R,11R,12R,16R,19S)-7-hydroxy-7,11,14,14,18,21,21-heptamethyl-19-triethylsilyloxy-2,4,13,15-tetraoxapentacyclo[15.3.1.01,5.06,11.012,16]henicos-17-en-3-one |
| SMILES | CC[Si](CC)(CC)O[C@H]1C[C@@]23OC(=O)O[C@H]2[C@H]2[C@@](C)(CCC[C@@]2(C)O)[C@H]2OC(C)(C)O[C@@H]2C(=C1C)C3(C)C |
| InChI | InChI=1S/C30H50O7Si/c1-11-38(12-2,13-3)37-19-17-30-24(33-25(31)36-30)22-28(9,15-14-16-29(22,10)32)23-21(34-27(7,8)35-23)20(18(19)4)26(30,5)6/h19,21-24,32H,11-17H2,1-10H3/t19-,21+,22-,23-,24-,28+,29+,30+/m0/s1 |
| InChIKey | BTTISDIBJCXWRL-XNFMWMOGSA-N |
| XLogP | 6.49 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.81 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|