C17H13N5O2S — CID 1090776
1-[4-[3-[5-(furan-2-yl)-1H-pyrazol-3-yl]-5-sulfanylidene-1H-1,2,4-triazol-4-yl]phenyl]ethanone (PubChem CID 1090776) has the molecular formula C17H13N5O2S and a molecular weight of 351.39 g/mol. Its IUPAC name is 1-[4-[3-[5-(furan-2-yl)-1H-pyrazol-3-yl]-5-sulfanylidene-1H-1,2,4-triazol-4-yl]phenyl]ethanone.
| Compound Name | 1-[4-[3-[5-(furan-2-yl)-1H-pyrazol-3-yl]-5-sulfanylidene-1H-1,2,4-triazol-4-yl]phenyl]ethanone |
|---|---|
| PubChem CID | 1090776 |
| Molecular Formula | C17H13N5O2S |
| Molecular Weight | 351.39 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | 1-[4-[3-[5-(furan-2-yl)-1H-pyrazol-3-yl]-5-sulfanylidene-1H-1,2,4-triazol-4-yl]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(-n2c(-c3cc(-c4ccco4)[nH]n3)n[nH]c2=S)cc1 |
| InChI | InChI=1S/C17H13N5O2S/c1-10(23)11-4-6-12(7-5-11)22-16(20-21-17(22)25)14-9-13(18-19-14)15-3-2-8-24-15/h2-9H,1H3,(H,18,19)(H,21,25) |
| InChIKey | YIVILBJKJXYRIP-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.39 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|