C30H60O5Si2 — CID 10907812
tert-butyl-[(2S,6S)-1-[tert-butyl(dimethyl)silyl]oxy-7-[(2R,6R)-6-[2-(methoxymethoxy)ethyl]-3,6-dihydro-2H-pyran-2-yl]-6-methyl-4-methylideneheptan-2-yl]oxy-dimethylsilane (PubChem CID 10907812) has the molecular formula C30H60O5Si2 and a molecular weight of 556.98 g/mol. Its IUPAC name is tert-butyl-[(2S,6S)-1-[tert-butyl(dimethyl)silyl]oxy-7-[(2R,6R)-6-[2-(methoxymethoxy)ethyl]-3,6-dihydro-2H-pyran-2-yl]-6-methyl-4-methylideneheptan-2-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(2S,6S)-1-[tert-butyl(dimethyl)silyl]oxy-7-[(2R,6R)-6-[2-(methoxymethoxy)ethyl]-3,6-dihydro-2H-pyran-2-yl]-6-methyl-4-methylideneheptan-2-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 10907812 |
| Molecular Formula | C30H60O5Si2 |
| Molecular Weight | 556.98 g/mol |
| Exact Mass | 556.40 |
| IUPAC Name | tert-butyl-[(2S,6S)-1-[tert-butyl(dimethyl)silyl]oxy-7-[(2R,6R)-6-[2-(methoxymethoxy)ethyl]-3,6-dihydro-2H-pyran-2-yl]-6-methyl-4-methylideneheptan-2-yl]oxy-dimethylsilane |
| SMILES | C=C(C[C@H](C)C[C@@H]1CC=C[C@@H](CCOCOC)O1)C[C@@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C30H60O5Si2/c1-24(20-27-16-14-15-26(34-27)17-18-32-23-31-9)19-25(2)21-28(35-37(12,13)30(6,7)8)22-33-36(10,11)29(3,4)5/h14-15,24,26-28H,2,16-23H2,1,3-13H3/t24-,26-,27-,28-/m0/s1 |
| InChIKey | ZVPQMSNDWZWWRH-VNNZRSTGSA-N |
| XLogP | 8.49 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.98 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|