C28H35ClN2O8 — CID 10907858
4-[[2-[(3R,5S)-7-chloro-5-(2,3-dimethoxyphenyl)-1-(3-hydroxy-2,2-dimethylpropyl)-2-oxo-5H-4,1-benzoxazepin-3-yl]acetyl]amino]butanoic acid (PubChem CID 10907858) has the molecular formula C28H35ClN2O8 and a molecular weight of 563.05 g/mol. Its IUPAC name is 4-[[2-[(3R,5S)-7-chloro-5-(2,3-dimethoxyphenyl)-1-(3-hydroxy-2,2-dimethylpropyl)-2-oxo-5H-4,1-benzoxazepin-3-yl]acetyl]amino]butanoic acid.
| Compound Name | 4-[[2-[(3R,5S)-7-chloro-5-(2,3-dimethoxyphenyl)-1-(3-hydroxy-2,2-dimethylpropyl)-2-oxo-5H-4,1-benzoxazepin-3-yl]acetyl]amino]butanoic acid |
|---|---|
| PubChem CID | 10907858 |
| Molecular Formula | C28H35ClN2O8 |
| Molecular Weight | 563.05 g/mol |
| Exact Mass | 562.21 |
| IUPAC Name | 4-[[2-[(3R,5S)-7-chloro-5-(2,3-dimethoxyphenyl)-1-(3-hydroxy-2,2-dimethylpropyl)-2-oxo-5H-4,1-benzoxazepin-3-yl]acetyl]amino]butanoic acid |
| SMILES | COc1cccc([C@H]2O[C@H](CC(=O)NCCCC(=O)O)C(=O)N(CC(C)(C)CO)c3ccc(Cl)cc32)c1OC |
| InChI | InChI=1S/C28H35ClN2O8/c1-28(2,16-32)15-31-20-11-10-17(29)13-19(20)25(18-7-5-8-21(37-3)26(18)38-4)39-22(27(31)36)14-23(33)30-12-6-9-24(34)35/h5,7-8,10-11,13,22,25,32H,6,9,12,14-16H2,1-4H3,(H,30,33)(H,34,35)/t22-,25-/m1/s1 |
| InChIKey | KTYPPQSEVZOCNA-RCZVLFRGSA-N |
| XLogP | 3.57 |
| TPSA | 134.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.05 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|