About 3-methyl-2,4,5-tris(phenylselanyl)thiophene
3-methyl-2,4,5-tris(phenylselanyl)thiophene (PubChem CID 10907859) has the molecular formula C23H18SSe3
and a molecular weight of 563.34 g/mol. Its IUPAC name is 3-methyl-2,4,5-tris(phenylselanyl)thiophene.
Molecular Properties
| Compound Name | 3-methyl-2,4,5-tris(phenylselanyl)thiophene |
| PubChem CID | 10907859 |
| Molecular Formula | C23H18SSe3 |
| Molecular Weight | 563.34 g/mol |
| Exact Mass | 565.86 |
| IUPAC Name | 3-methyl-2,4,5-tris(phenylselanyl)thiophene |
| SMILES | Cc1c([Se]c2ccccc2)sc([Se]c2ccccc2)c1[Se]c1ccccc1 |
| InChI | InChI=1S/C23H18SSe3/c1-17-21(25-18-11-5-2-6-12-18)23(27-20-15-9-4-10-16-20)24-22(17)26-19-13-7-3-8-14-19/h2-16H,1H3 |
| InChIKey | ZCBCEJLTMYQSQE-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 563.34 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-2,4,5-tris(phenylselanyl)thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-2,4,5-tris(phenylselanyl)thiophene?
The IUPAC name of 3-methyl-2,4,5-tris(phenylselanyl)thiophene (CID 10907859) is 3-methyl-2,4,5-tris(phenylselanyl)thiophene.
What is the SMILES notation for 3-methyl-2,4,5-tris(phenylselanyl)thiophene?
The canonical SMILES for 3-methyl-2,4,5-tris(phenylselanyl)thiophene is Cc1c([Se]c2ccccc2)sc([Se]c2ccccc2)c1[Se]c1ccccc1.
What is the InChIKey of 3-methyl-2,4,5-tris(phenylselanyl)thiophene?
The InChIKey is ZCBCEJLTMYQSQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H18SSe3/c1-17-21(25-18-11-5-2-6-12-18)23(27-20-15-9-4-10-16-20)24-22(17)26-19-13-7-3-8-14-19/h2-16H,1H3.
What are the key properties of 3-methyl-2,4,5-tris(phenylselanyl)thiophene?
3-methyl-2,4,5-tris(phenylselanyl)thiophene has a molecular weight of 563.34 g/mol, XLogP of 1.02, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-2,4,5-tris(phenylselanyl)thiophene is sourced from PubChem (CID 10907859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).