C18H19N3O2 — CID 109078816
2-N-[(3-methylphenyl)methyl]-4-N-prop-2-enylpyridine-2,4-dicarboxamide (PubChem CID 109078816) has the molecular formula C18H19N3O2 and a molecular weight of 309.37 g/mol. Its IUPAC name is 2-N-[(3-methylphenyl)methyl]-4-N-prop-2-enylpyridine-2,4-dicarboxamide.
| Compound Name | 2-N-[(3-methylphenyl)methyl]-4-N-prop-2-enylpyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109078816 |
| Molecular Formula | C18H19N3O2 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 2-N-[(3-methylphenyl)methyl]-4-N-prop-2-enylpyridine-2,4-dicarboxamide |
| SMILES | C=CCNC(=O)c1ccnc(C(=O)NCc2cccc(C)c2)c1 |
| InChI | InChI=1S/C18H19N3O2/c1-3-8-20-17(22)15-7-9-19-16(11-15)18(23)21-12-14-6-4-5-13(2)10-14/h3-7,9-11H,1,8,12H2,2H3,(H,20,22)(H,21,23) |
| InChIKey | KPLHOAUXIMVVBK-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|