C16H14FN3O2 — CID 109078904
2-N-(2-fluorophenyl)-4-N-prop-2-enylpyridine-2,4-dicarboxamide (PubChem CID 109078904) has the molecular formula C16H14FN3O2 and a molecular weight of 299.31 g/mol. Its IUPAC name is 2-N-(2-fluorophenyl)-4-N-prop-2-enylpyridine-2,4-dicarboxamide.
| Compound Name | 2-N-(2-fluorophenyl)-4-N-prop-2-enylpyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109078904 |
| Molecular Formula | C16H14FN3O2 |
| Molecular Weight | 299.31 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | 2-N-(2-fluorophenyl)-4-N-prop-2-enylpyridine-2,4-dicarboxamide |
| SMILES | C=CCNC(=O)c1ccnc(C(=O)Nc2ccccc2F)c1 |
| InChI | InChI=1S/C16H14FN3O2/c1-2-8-19-15(21)11-7-9-18-14(10-11)16(22)20-13-6-4-3-5-12(13)17/h2-7,9-10H,1,8H2,(H,19,21)(H,20,22) |
| InChIKey | DIMHGJLVNWXGSP-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.31 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|