C26H45BrO7Si — CID 10907976
2-[(2S,4R,6R)-6-[(1R,2E,4E,6R,8E)-9-bromo-1-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-3-methylnona-2,4,8-trienyl]-2,4-dimethoxyoxan-2-yl]acetic acid (PubChem CID 10907976) has the molecular formula C26H45BrO7Si and a molecular weight of 577.63 g/mol. Its IUPAC name is 2-[(2S,4R,6R)-6-[(1R,2E,4E,6R,8E)-9-bromo-1-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-3-methylnona-2,4,8-trienyl]-2,4-dimethoxyoxan-2-yl]acetic acid.
| Compound Name | 2-[(2S,4R,6R)-6-[(1R,2E,4E,6R,8E)-9-bromo-1-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-3-methylnona-2,4,8-trienyl]-2,4-dimethoxyoxan-2-yl]acetic acid |
|---|---|
| PubChem CID | 10907976 |
| Molecular Formula | C26H45BrO7Si |
| Molecular Weight | 577.63 g/mol |
| Exact Mass | 576.21 |
| IUPAC Name | 2-[(2S,4R,6R)-6-[(1R,2E,4E,6R,8E)-9-bromo-1-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-3-methylnona-2,4,8-trienyl]-2,4-dimethoxyoxan-2-yl]acetic acid |
| SMILES | CO[C@@H]1C[C@H]([C@@H](/C=C(C)/C=C/[C@@H](C/C=C/Br)OC)O[Si](C)(C)C(C)(C)C)O[C@@](CC(=O)O)(OC)C1 |
| InChI | InChI=1S/C26H45BrO7Si/c1-19(12-13-20(30-5)11-10-14-27)15-23(34-35(8,9)25(2,3)4)22-16-21(31-6)17-26(32-7,33-22)18-24(28)29/h10,12-15,20-23H,11,16-18H2,1-9H3,(H,28,29)/b13-12+,14-10+,19-15+/t20-,21-,22-,23-,26+/m1/s1 |
| InChIKey | FYFVKPPXWCFCNK-HGFGHAIYSA-N |
| XLogP | 6.20 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.63 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|