C26H51IO2Si2 — CID 10907988
tert-butyl-[(2Z,5R,6E,8Z,10S)-5-[tert-butyl(dimethyl)silyl]oxy-8-ethyl-11-iodo-10-methylundeca-2,6,8-trienoxy]-dimethylsilane (PubChem CID 10907988) has the molecular formula C26H51IO2Si2 and a molecular weight of 578.77 g/mol. Its IUPAC name is tert-butyl-[(2Z,5R,6E,8Z,10S)-5-[tert-butyl(dimethyl)silyl]oxy-8-ethyl-11-iodo-10-methylundeca-2,6,8-trienoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(2Z,5R,6E,8Z,10S)-5-[tert-butyl(dimethyl)silyl]oxy-8-ethyl-11-iodo-10-methylundeca-2,6,8-trienoxy]-dimethylsilane |
|---|---|
| PubChem CID | 10907988 |
| Molecular Formula | C26H51IO2Si2 |
| Molecular Weight | 578.77 g/mol |
| Exact Mass | 578.25 |
| IUPAC Name | tert-butyl-[(2Z,5R,6E,8Z,10S)-5-[tert-butyl(dimethyl)silyl]oxy-8-ethyl-11-iodo-10-methylundeca-2,6,8-trienoxy]-dimethylsilane |
| SMILES | CCC(=C/[C@H](C)CI)/C=C/[C@@H](C/C=C\CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H51IO2Si2/c1-13-23(20-22(2)21-27)17-18-24(29-31(11,12)26(6,7)8)16-14-15-19-28-30(9,10)25(3,4)5/h14-15,17-18,20,22,24H,13,16,19,21H2,1-12H3/b15-14-,18-17+,23-20-/t22-,24+/m0/s1 |
| InChIKey | ZNLRWQOZIMZZDY-GJWPYDAGSA-N |
| XLogP | 9.31 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.77 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|