C6H18NO20P5 — CID 10907989
[(1R,2S,4R,5R)-3-amino-2,4,5,6-tetraphosphonooxycyclohexyl] dihydrogen phosphate (PubChem CID 10907989) has the molecular formula C6H18NO20P5 and a molecular weight of 579.07 g/mol. Its IUPAC name is [(1R,2S,4R,5R)-3-amino-2,4,5,6-tetraphosphonooxycyclohexyl] dihydrogen phosphate.
| Compound Name | [(1R,2S,4R,5R)-3-amino-2,4,5,6-tetraphosphonooxycyclohexyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 10907989 |
| Molecular Formula | C6H18NO20P5 |
| Molecular Weight | 579.07 g/mol |
| Exact Mass | 578.91 |
| IUPAC Name | [(1R,2S,4R,5R)-3-amino-2,4,5,6-tetraphosphonooxycyclohexyl] dihydrogen phosphate |
| SMILES | NC1[C@@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O)C(OP(=O)(O)O)[C@H](OP(=O)(O)O)[C@H]1OP(=O)(O)O |
| InChI | InChI=1S/C6H18NO20P5/c7-1-2(23-28(8,9)10)4(25-30(14,15)16)6(27-32(20,21)22)5(26-31(17,18)19)3(1)24-29(11,12)13/h1-6H,7H2,(H2,8,9,10)(H2,11,12,13)(H2,14,15,16)(H2,17,18,19)(H2,20,21,22)/t1?,2-,3+,4-,5-,6?/m1/s1 |
| InChIKey | CVTNDEFWYPCBSP-GCVPSNMTSA-N |
| XLogP | -3.28 |
| TPSA | 359.82 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.07 |
| LogP ≤ 5 | -3.28 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|