C33H64O4Si2 — CID 10908005
methyl (5S,6Z,8E,12S,14Z)-5,12-bis[[tert-butyl(dimethyl)silyl]oxy]icosa-6,8,14-trienoate (PubChem CID 10908005) has the molecular formula C33H64O4Si2 and a molecular weight of 581.04 g/mol. Its IUPAC name is methyl (5S,6Z,8E,12S,14Z)-5,12-bis[[tert-butyl(dimethyl)silyl]oxy]icosa-6,8,14-trienoate.
| Compound Name | methyl (5S,6Z,8E,12S,14Z)-5,12-bis[[tert-butyl(dimethyl)silyl]oxy]icosa-6,8,14-trienoate |
|---|---|
| PubChem CID | 10908005 |
| Molecular Formula | C33H64O4Si2 |
| Molecular Weight | 581.04 g/mol |
| Exact Mass | 580.43 |
| IUPAC Name | methyl (5S,6Z,8E,12S,14Z)-5,12-bis[[tert-butyl(dimethyl)silyl]oxy]icosa-6,8,14-trienoate |
| SMILES | CCCCC/C=C\C[C@H](CC/C=C/C=C\[C@H](CCCC(=O)OC)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C33H64O4Si2/c1-13-14-15-16-17-20-24-29(36-38(9,10)32(2,3)4)25-21-18-19-22-26-30(27-23-28-31(34)35-8)37-39(11,12)33(5,6)7/h17-20,22,26,29-30H,13-16,21,23-25,27-28H2,1-12H3/b19-18+,20-17-,26-22-/t29-,30-/m1/s1 |
| InChIKey | PUTQDQOYFZGGBZ-ZWCOEYEWSA-N |
| XLogP | 10.53 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.04 |
| LogP ≤ 5 | 10.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|