C19H23N3O4 — CID 109080066
4-N-butan-2-yl-2-N-(2,5-dimethoxyphenyl)pyridine-2,4-dicarboxamide (PubChem CID 109080066) has the molecular formula C19H23N3O4 and a molecular weight of 357.41 g/mol. Its IUPAC name is 4-N-butan-2-yl-2-N-(2,5-dimethoxyphenyl)pyridine-2,4-dicarboxamide.
| Compound Name | 4-N-butan-2-yl-2-N-(2,5-dimethoxyphenyl)pyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109080066 |
| Molecular Formula | C19H23N3O4 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 4-N-butan-2-yl-2-N-(2,5-dimethoxyphenyl)pyridine-2,4-dicarboxamide |
| SMILES | CCC(C)NC(=O)c1ccnc(C(=O)Nc2cc(OC)ccc2OC)c1 |
| InChI | InChI=1S/C19H23N3O4/c1-5-12(2)21-18(23)13-8-9-20-16(10-13)19(24)22-15-11-14(25-3)6-7-17(15)26-4/h6-12H,5H2,1-4H3,(H,21,23)(H,22,24) |
| InChIKey | OPZAWLWUECGINL-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |