C21H26O8SSi — CID 10908060
3-O-ethyl 1-O,2-O-dimethyl 5-(benzenesulfonyl)-4-trimethylsilylcyclopenta-1,4-diene-1,2,3-tricarboxylate (PubChem CID 10908060) has the molecular formula C21H26O8SSi and a molecular weight of 466.58 g/mol. Its IUPAC name is 3-O-ethyl 1-O,2-O-dimethyl 5-(benzenesulfonyl)-4-trimethylsilylcyclopenta-1,4-diene-1,2,3-tricarboxylate.
| Compound Name | 3-O-ethyl 1-O,2-O-dimethyl 5-(benzenesulfonyl)-4-trimethylsilylcyclopenta-1,4-diene-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 10908060 |
| Molecular Formula | C21H26O8SSi |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.11 |
| IUPAC Name | 3-O-ethyl 1-O,2-O-dimethyl 5-(benzenesulfonyl)-4-trimethylsilylcyclopenta-1,4-diene-1,2,3-tricarboxylate |
| SMILES | CCOC(=O)C1C(C(=O)OC)=C(C(=O)OC)C(S(=O)(=O)c2ccccc2)=C1[Si](C)(C)C |
| InChI | InChI=1S/C21H26O8SSi/c1-7-29-21(24)16-14(19(22)27-2)15(20(23)28-3)17(18(16)31(4,5)6)30(25,26)13-11-9-8-10-12-13/h8-12,16H,7H2,1-6H3 |
| InChIKey | PJFUXVNUFQUZBG-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|