C18H17Cl2N3O2 — CID 109081176
N-(2,6-dichlorophenyl)-4-(piperidine-1-carbonyl)pyridine-2-carboxamide (PubChem CID 109081176) has the molecular formula C18H17Cl2N3O2 and a molecular weight of 378.26 g/mol. Its IUPAC name is N-(2,6-dichlorophenyl)-4-(piperidine-1-carbonyl)pyridine-2-carboxamide.
| Compound Name | N-(2,6-dichlorophenyl)-4-(piperidine-1-carbonyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109081176 |
| Molecular Formula | C18H17Cl2N3O2 |
| Molecular Weight | 378.26 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | N-(2,6-dichlorophenyl)-4-(piperidine-1-carbonyl)pyridine-2-carboxamide |
| SMILES | O=C(Nc1c(Cl)cccc1Cl)c1cc(C(=O)N2CCCCC2)ccn1 |
| InChI | InChI=1S/C18H17Cl2N3O2/c19-13-5-4-6-14(20)16(13)22-17(24)15-11-12(7-8-21-15)18(25)23-9-2-1-3-10-23/h4-8,11H,1-3,9-10H2,(H,22,24) |
| InChIKey | YYJXYTWUGWYNLW-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.26 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |