C25H25N3O2 — CID 109081326
N-benzyl-N-phenyl-2-(piperidine-1-carbonyl)pyridine-4-carboxamide (PubChem CID 109081326) has the molecular formula C25H25N3O2 and a molecular weight of 399.49 g/mol. Its IUPAC name is N-benzyl-N-phenyl-2-(piperidine-1-carbonyl)pyridine-4-carboxamide.
| Compound Name | N-benzyl-N-phenyl-2-(piperidine-1-carbonyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 109081326 |
| Molecular Formula | C25H25N3O2 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | N-benzyl-N-phenyl-2-(piperidine-1-carbonyl)pyridine-4-carboxamide |
| SMILES | O=C(c1cc(C(=O)N(Cc2ccccc2)c2ccccc2)ccn1)N1CCCCC1 |
| InChI | InChI=1S/C25H25N3O2/c29-24(21-14-15-26-23(18-21)25(30)27-16-8-3-9-17-27)28(22-12-6-2-7-13-22)19-20-10-4-1-5-11-20/h1-2,4-7,10-15,18H,3,8-9,16-17,19H2 |
| InChIKey | WSKXUDWTEGXNEB-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |