C19H28N4O2 — CID 109081659
[2-(4-ethylpiperazine-1-carbonyl)-4-pyridinyl]-(4-methylpiperidin-1-yl)methanone (PubChem CID 109081659) has the molecular formula C19H28N4O2 and a molecular weight of 344.46 g/mol. Its IUPAC name is [2-(4-ethylpiperazine-1-carbonyl)-4-pyridinyl]-(4-methylpiperidin-1-yl)methanone.
| Compound Name | [2-(4-ethylpiperazine-1-carbonyl)-4-pyridinyl]-(4-methylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 109081659 |
| Molecular Formula | C19H28N4O2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | [2-(4-ethylpiperazine-1-carbonyl)-4-pyridinyl]-(4-methylpiperidin-1-yl)methanone |
| SMILES | CCN1CCN(C(=O)c2cc(C(=O)N3CCC(C)CC3)ccn2)CC1 |
| InChI | InChI=1S/C19H28N4O2/c1-3-21-10-12-23(13-11-21)19(25)17-14-16(4-7-20-17)18(24)22-8-5-15(2)6-9-22/h4,7,14-15H,3,5-6,8-13H2,1-2H3 |
| InChIKey | GNDVLKBGTMCCBJ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |