C20H23N3O3 — CID 109081898
N-(4-methoxyphenyl)-2-(4-methylpiperidine-1-carbonyl)pyridine-4-carboxamide (PubChem CID 109081898) has the molecular formula C20H23N3O3 and a molecular weight of 353.42 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-2-(4-methylpiperidine-1-carbonyl)pyridine-4-carboxamide.
| Compound Name | N-(4-methoxyphenyl)-2-(4-methylpiperidine-1-carbonyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 109081898 |
| Molecular Formula | C20H23N3O3 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | N-(4-methoxyphenyl)-2-(4-methylpiperidine-1-carbonyl)pyridine-4-carboxamide |
| SMILES | COc1ccc(NC(=O)c2ccnc(C(=O)N3CCC(C)CC3)c2)cc1 |
| InChI | InChI=1S/C20H23N3O3/c1-14-8-11-23(12-9-14)20(25)18-13-15(7-10-21-18)19(24)22-16-3-5-17(26-2)6-4-16/h3-7,10,13-14H,8-9,11-12H2,1-2H3,(H,22,24) |
| InChIKey | UHYHWOZZIFNVPN-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |