C32H41ClN2O8 — CID 10908260
3-[1-[2-[(3R,5S)-7-chloro-5-(2,3-dimethoxyphenyl)-1-(3-hydroxy-2,2-dimethylpropyl)-2-oxo-5H-4,1-benzoxazepin-3-yl]acetyl]piperidin-4-yl]propanoic acid (PubChem CID 10908260) has the molecular formula C32H41ClN2O8 and a molecular weight of 617.14 g/mol. Its IUPAC name is 3-[1-[2-[(3R,5S)-7-chloro-5-(2,3-dimethoxyphenyl)-1-(3-hydroxy-2,2-dimethylpropyl)-2-oxo-5H-4,1-benzoxazepin-3-yl]acetyl]piperidin-4-yl]propanoic acid.
| Compound Name | 3-[1-[2-[(3R,5S)-7-chloro-5-(2,3-dimethoxyphenyl)-1-(3-hydroxy-2,2-dimethylpropyl)-2-oxo-5H-4,1-benzoxazepin-3-yl]acetyl]piperidin-4-yl]propanoic acid |
|---|---|
| PubChem CID | 10908260 |
| Molecular Formula | C32H41ClN2O8 |
| Molecular Weight | 617.14 g/mol |
| Exact Mass | 616.26 |
| IUPAC Name | 3-[1-[2-[(3R,5S)-7-chloro-5-(2,3-dimethoxyphenyl)-1-(3-hydroxy-2,2-dimethylpropyl)-2-oxo-5H-4,1-benzoxazepin-3-yl]acetyl]piperidin-4-yl]propanoic acid |
| SMILES | COc1cccc([C@H]2O[C@H](CC(=O)N3CCC(CCC(=O)O)CC3)C(=O)N(CC(C)(C)CO)c3ccc(Cl)cc32)c1OC |
| InChI | InChI=1S/C32H41ClN2O8/c1-32(2,19-36)18-35-24-10-9-21(33)16-23(24)29(22-6-5-7-25(41-3)30(22)42-4)43-26(31(35)40)17-27(37)34-14-12-20(13-15-34)8-11-28(38)39/h5-7,9-10,16,20,26,29,36H,8,11-15,17-19H2,1-4H3,(H,38,39)/t26-,29-/m1/s1 |
| InChIKey | IXOZUHCLABVHKZ-GGXMVOPNSA-N |
| XLogP | 4.69 |
| TPSA | 125.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.14 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |