About 5-cyclopenta-2,4-dien-1-ylidenecyclopenta-1,3-diene
5-cyclopenta-2,4-dien-1-ylidenecyclopenta-1,3-diene (PubChem CID 10908294) has the molecular formula C10H8
and a molecular weight of 128.17 g/mol. Its IUPAC name is 5-cyclopenta-2,4-dien-1-ylidenecyclopenta-1,3-diene.
Molecular Properties
| Compound Name | 5-cyclopenta-2,4-dien-1-ylidenecyclopenta-1,3-diene |
| PubChem CID | 10908294 |
| Molecular Formula | C10H8 |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.06 |
| IUPAC Name | 5-cyclopenta-2,4-dien-1-ylidenecyclopenta-1,3-diene |
| SMILES | C1=CC(=C2C=CC=C2)C=C1 |
| InChI | InChI=1S/C10H8/c1-2-6-9(5-1)10-7-3-4-8-10/h1-8H |
| InChIKey | XEOSBIMHSUFHQH-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 5-cyclopenta-2,4-dien-1-ylidenecyclopenta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclopenta-2,4-dien-1-ylidenecyclopenta-1,3-diene?
The IUPAC name of 5-cyclopenta-2,4-dien-1-ylidenecyclopenta-1,3-diene (CID 10908294) is 5-cyclopenta-2,4-dien-1-ylidenecyclopenta-1,3-diene.
What is the SMILES notation for 5-cyclopenta-2,4-dien-1-ylidenecyclopenta-1,3-diene?
The canonical SMILES for 5-cyclopenta-2,4-dien-1-ylidenecyclopenta-1,3-diene is C1=CC(=C2C=CC=C2)C=C1.
What is the InChIKey of 5-cyclopenta-2,4-dien-1-ylidenecyclopenta-1,3-diene?
The InChIKey is XEOSBIMHSUFHQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8/c1-2-6-9(5-1)10-7-3-4-8-10/h1-8H.
What are the key properties of 5-cyclopenta-2,4-dien-1-ylidenecyclopenta-1,3-diene?
5-cyclopenta-2,4-dien-1-ylidenecyclopenta-1,3-diene has a molecular weight of 128.17 g/mol, XLogP of 2.54, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclopenta-2,4-dien-1-ylidenecyclopenta-1,3-diene is sourced from PubChem (CID 10908294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).