C32H51F3N2O8 — CID 10908421
[(2S,3S,4R,5R,6R)-5-acetyloxy-6-[(5R,6R)-6-ethyl-9-[[(2R)-2-ethylhex-5-enoyl]amino]-2-methylnon-1-en-5-yl]oxy-2-methyl-4-[(2,2,2-trifluoroacetyl)amino]oxan-3-yl] acetate (PubChem CID 10908421) has the molecular formula C32H51F3N2O8 and a molecular weight of 648.76 g/mol. Its IUPAC name is [(2S,3S,4R,5R,6R)-5-acetyloxy-6-[(5R,6R)-6-ethyl-9-[[(2R)-2-ethylhex-5-enoyl]amino]-2-methylnon-1-en-5-yl]oxy-2-methyl-4-[(2,2,2-trifluoroacetyl)amino]oxan-3-yl] acetate.
| Compound Name | [(2S,3S,4R,5R,6R)-5-acetyloxy-6-[(5R,6R)-6-ethyl-9-[[(2R)-2-ethylhex-5-enoyl]amino]-2-methylnon-1-en-5-yl]oxy-2-methyl-4-[(2,2,2-trifluoroacetyl)amino]oxan-3-yl] acetate |
|---|---|
| PubChem CID | 10908421 |
| Molecular Formula | C32H51F3N2O8 |
| Molecular Weight | 648.76 g/mol |
| Exact Mass | 648.36 |
| IUPAC Name | [(2S,3S,4R,5R,6R)-5-acetyloxy-6-[(5R,6R)-6-ethyl-9-[[(2R)-2-ethylhex-5-enoyl]amino]-2-methylnon-1-en-5-yl]oxy-2-methyl-4-[(2,2,2-trifluoroacetyl)amino]oxan-3-yl] acetate |
| SMILES | C=CCC[C@@H](CC)C(=O)NCCC[C@@H](CC)[C@@H](CCC(=C)C)O[C@@H]1O[C@@H](C)[C@@H](OC(C)=O)[C@@H](NC(=O)C(F)(F)F)[C@H]1OC(C)=O |
| InChI | InChI=1S/C32H51F3N2O8/c1-9-12-14-24(11-3)29(40)36-18-13-15-23(10-2)25(17-16-19(4)5)45-30-28(44-22(8)39)26(37-31(41)32(33,34)35)27(20(6)42-30)43-21(7)38/h9,20,23-28,30H,1,4,10-18H2,2-3,5-8H3,(H,36,40)(H,37,41)/t20-,23+,24+,25+,26+,27+,28+,30-/m0/s1 |
| InChIKey | CLQLBWRGALRZQH-VZLQGKTJSA-N |
| XLogP | 5.30 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.76 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|