C36H70O6Si2 — CID 10908461
(1R,3R,4S,6R,8R,10S,12R,13S)-12-ethenyl-1-methyl-4-tri(propan-2-yl)silyloxy-6-[3-tri(propan-2-yl)silyloxypropyl]-2,7,11-trioxatricyclo[8.5.0.03,8]pentadecan-13-ol (PubChem CID 10908461) has the molecular formula C36H70O6Si2 and a molecular weight of 655.12 g/mol. Its IUPAC name is (1R,3R,4S,6R,8R,10S,12R,13S)-12-ethenyl-1-methyl-4-tri(propan-2-yl)silyloxy-6-[3-tri(propan-2-yl)silyloxypropyl]-2,7,11-trioxatricyclo[8.5.0.03,8]pentadecan-13-ol.
| Compound Name | (1R,3R,4S,6R,8R,10S,12R,13S)-12-ethenyl-1-methyl-4-tri(propan-2-yl)silyloxy-6-[3-tri(propan-2-yl)silyloxypropyl]-2,7,11-trioxatricyclo[8.5.0.03,8]pentadecan-13-ol |
|---|---|
| PubChem CID | 10908461 |
| Molecular Formula | C36H70O6Si2 |
| Molecular Weight | 655.12 g/mol |
| Exact Mass | 654.47 |
| IUPAC Name | (1R,3R,4S,6R,8R,10S,12R,13S)-12-ethenyl-1-methyl-4-tri(propan-2-yl)silyloxy-6-[3-tri(propan-2-yl)silyloxypropyl]-2,7,11-trioxatricyclo[8.5.0.03,8]pentadecan-13-ol |
| SMILES | C=C[C@H]1O[C@H]2C[C@H]3O[C@H](CCCO[Si](C(C)C)(C(C)C)C(C)C)C[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H]3O[C@]2(C)CC[C@@H]1O |
| InChI | InChI=1S/C36H70O6Si2/c1-15-31-30(37)18-19-36(14)34(40-31)22-32-35(41-36)33(42-44(26(8)9,27(10)11)28(12)13)21-29(39-32)17-16-20-38-43(23(2)3,24(4)5)25(6)7/h15,23-35,37H,1,16-22H2,2-14H3/t29-,30+,31-,32-,33+,34+,35-,36-/m1/s1 |
| InChIKey | MXJJYPXJMWYRBS-FJIWXNQSSA-N |
| XLogP | 9.32 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.12 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|