C21H18FN3O2 — CID 109085281
4-N-benzyl-2-N-[(4-fluorophenyl)methyl]pyridine-2,4-dicarboxamide (PubChem CID 109085281) has the molecular formula C21H18FN3O2 and a molecular weight of 363.39 g/mol. Its IUPAC name is 4-N-benzyl-2-N-[(4-fluorophenyl)methyl]pyridine-2,4-dicarboxamide.
| Compound Name | 4-N-benzyl-2-N-[(4-fluorophenyl)methyl]pyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109085281 |
| Molecular Formula | C21H18FN3O2 |
| Molecular Weight | 363.39 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | 4-N-benzyl-2-N-[(4-fluorophenyl)methyl]pyridine-2,4-dicarboxamide |
| SMILES | O=C(NCc1ccccc1)c1ccnc(C(=O)NCc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C21H18FN3O2/c22-18-8-6-16(7-9-18)14-25-21(27)19-12-17(10-11-23-19)20(26)24-13-15-4-2-1-3-5-15/h1-12H,13-14H2,(H,24,26)(H,25,27) |
| InChIKey | LFGIWMWMCNHWJV-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.39 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |