C21H27N3O2 — CID 109085537
4-N-[(2-methylphenyl)methyl]-2-N,2-N-dipropylpyridine-2,4-dicarboxamide (PubChem CID 109085537) has the molecular formula C21H27N3O2 and a molecular weight of 353.47 g/mol. Its IUPAC name is 4-N-[(2-methylphenyl)methyl]-2-N,2-N-dipropylpyridine-2,4-dicarboxamide.
| Compound Name | 4-N-[(2-methylphenyl)methyl]-2-N,2-N-dipropylpyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109085537 |
| Molecular Formula | C21H27N3O2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | 4-N-[(2-methylphenyl)methyl]-2-N,2-N-dipropylpyridine-2,4-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)c1cc(C(=O)NCc2ccccc2C)ccn1 |
| InChI | InChI=1S/C21H27N3O2/c1-4-12-24(13-5-2)21(26)19-14-17(10-11-22-19)20(25)23-15-18-9-7-6-8-16(18)3/h6-11,14H,4-5,12-13,15H2,1-3H3,(H,23,25) |
| InChIKey | UBTHIOXKYYPJGX-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |