C22H20FN3O2 — CID 109086006
2-N-[(2-fluorophenyl)methyl]-4-N-(1-phenylethyl)pyridine-2,4-dicarboxamide (PubChem CID 109086006) has the molecular formula C22H20FN3O2 and a molecular weight of 377.42 g/mol. Its IUPAC name is 2-N-[(2-fluorophenyl)methyl]-4-N-(1-phenylethyl)pyridine-2,4-dicarboxamide.
| Compound Name | 2-N-[(2-fluorophenyl)methyl]-4-N-(1-phenylethyl)pyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109086006 |
| Molecular Formula | C22H20FN3O2 |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | 2-N-[(2-fluorophenyl)methyl]-4-N-(1-phenylethyl)pyridine-2,4-dicarboxamide |
| SMILES | CC(NC(=O)c1ccnc(C(=O)NCc2ccccc2F)c1)c1ccccc1 |
| InChI | InChI=1S/C22H20FN3O2/c1-15(16-7-3-2-4-8-16)26-21(27)17-11-12-24-20(13-17)22(28)25-14-18-9-5-6-10-19(18)23/h2-13,15H,14H2,1H3,(H,25,28)(H,26,27) |
| InChIKey | WTVHRWSWNYFQFN-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |